2-DIFLUORO DIPHENYL DISULFIDE

2-DIFLUORO DIPHENYL DISULFIDE - Names and Identifiers

Name	2,2'-Difluorodiphenyl disulfide
Synonyms	2,2'-Difluoro 2,2'-DIFLUORO DIPHEN -Difluorodiphenyldisulfide 2-DIFLUORO DIPHENYL DISULFIDE Disulfide, bis(2-fluorophenyl) 2,2-Difluoro diphenyl disulfide 2,2'-Difluorodiphenyl disulfide 2,2'-DIFLUORO DIPHENYL DISULFIDE 1,1'-disulfanediylbis(2-fluorobenzene) 1-fluoro-2-[(2-fluorophenyl)disulfanyl]benzene
CAS	14135-38-7
InChI	InChI=1/C12H8F2S2/c13-9-5-1-3-7-11(9)15-16-12-8-4-2-6-10(12)14/h1-8H

2-DIFLUORO DIPHENYL DISULFIDE - Physico-chemical Properties

Molecular Formula	C12H8F2S2
Molar Mass	254.32
Density	1.35±0.1 g/cm3(Predicted)
Boling Point	292.2±25.0 °C(Predicted)
Flash Point	130.506°C
Vapor Presure	0.003mmHg at 25°C
Storage Condition	2-8°C
Refractive Index	1.64

2-DIFLUORO DIPHENYL DISULFIDE - Introduction

2,2 '-Difluorodiphenyl disulfide, chemical formula C12H8F2S2, is an organic compound. The following is a description of its nature, use, formulation and safety information:

Nature:
1. appearance: 2,2 '-difluoro diphenyl disulfide is a colorless to light yellow solid material.
2. melting point: its melting point is 70-72 ℃.
3. Boiling point: Its boiling point is 218-220 ℃.
4. Solubility: It is soluble in common organic solvents such as toluene, dimethylformamide, etc.

Use:
1. 2,2 '-difluorodiphenyl disulfide is commonly used as an intermediate in organic synthesis. It can be used to synthesize a series of organic compounds, such as anticancer drugs and pesticides.
2. It can also be used as a heterocyclic organic reaction reagent and play an important role in organic synthesis.

Preparation Method:
The preparation method of 2,2 '-difluorodiphenyl disulfide is relatively simple, and is generally carried out according to the following steps:
1. First, sodium benzenesulfonate difluoride is reacted with benzenesulfonic acid to obtain an intermediate of difluorodiphenyl disulfide.
2. Then, the intermediate is converted into 2,2 '-difluorodiphenyl disulfide by reduction reaction or using a reducing agent.

Safety Information:
1. 2,2 '-difluorodiphenyl disulfide is irritating. Avoid contact with skin and eyes during operation to avoid irritation or damage.
2. use should avoid inhalation of its dust or vapor, so as not to cause damage to the respiratory tract.
3. Keep good ventilation during use and take necessary personal protective measures, such as wearing gloves, goggles and protective clothing.
4. Keep away from fire and heat sources during storage and handling to avoid fire or explosion.

Please note that when using chemical substances, follow correct operating procedures and laboratory safety guidelines, and consult professionals when necessary.

Last Update：2024-04-09 21:01:54